Edited

Carbohydrate would be Cx(H2O)y

Olive Oil is a complex compound made of fatty acids, vitamins, volatile components, water soluble components and microscopic bits of olive. Primary fatty acids are Oleic and linoleic acid.

Oleic acid is monosaturated and makes up 55-85% of olive oil
(C17H35COOH) or CH3-(CH2)7-CH=CH-(CH2)7-COOH also known as oleate.
The IUPAC name would be cis-9-octadecenoate
Linoleic is polyunsaturated and makes up about 9%
(C17H29COOH) or CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7-COOH
Linolenic, which is polyunsaturated, makes up 0-1.5%
Vitamins are Vitamin E and carotene
Tweet